C23H18Cl2N4O2S2 — CID 19679406
methyl 2-[[1-[(2,4-dichlorophenyl)methyl]pyrazol-4-yl]carbamothioylamino]-5-phenylthiophene-3-carboxylate (PubChem CID 19679406) has the molecular formula C23H18Cl2N4O2S2 and a molecular weight of 517.46 g/mol. Its IUPAC name is methyl 2-[[1-[(2,4-dichlorophenyl)methyl]pyrazol-4-yl]carbamothioylamino]-5-phenylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[1-[(2,4-dichlorophenyl)methyl]pyrazol-4-yl]carbamothioylamino]-5-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19679406 |
| Molecular Formula | C23H18Cl2N4O2S2 |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 516.02 |
| IUPAC Name | methyl 2-[[1-[(2,4-dichlorophenyl)methyl]pyrazol-4-yl]carbamothioylamino]-5-phenylthiophene-3-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccccc2)sc1NC(=S)Nc1cnn(Cc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C23H18Cl2N4O2S2/c1-31-22(30)18-10-20(14-5-3-2-4-6-14)33-21(18)28-23(32)27-17-11-26-29(13-17)12-15-7-8-16(24)9-19(15)25/h2-11,13H,12H2,1H3,(H2,27,28,32) |
| InChIKey | FFXODDARQPREPF-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|