C23H18ClFN4O2S2 — CID 3292150
methyl 2-[[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]carbamothioylamino]-5-phenylthiophene-3-carboxylate (PubChem CID 3292150) has the molecular formula C23H18ClFN4O2S2 and a molecular weight of 501.01 g/mol. Its IUPAC name is methyl 2-[[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]carbamothioylamino]-5-phenylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]carbamothioylamino]-5-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 3292150 |
| Molecular Formula | C23H18ClFN4O2S2 |
| Molecular Weight | 501.01 g/mol |
| Exact Mass | 500.05 |
| IUPAC Name | methyl 2-[[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]carbamothioylamino]-5-phenylthiophene-3-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccccc2)sc1NC(=S)Nc1ccn(Cc2c(F)cccc2Cl)n1 |
| InChI | InChI=1S/C23H18ClFN4O2S2/c1-31-22(30)15-12-19(14-6-3-2-4-7-14)33-21(15)27-23(32)26-20-10-11-29(28-20)13-16-17(24)8-5-9-18(16)25/h2-12H,13H2,1H3,(H2,26,27,28,32) |
| InChIKey | GOWNQZPUCMMTHY-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.01 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|