C18H18N4O2S2 — CID 5193072
methyl 2-[(1-benzylpyrazol-3-yl)carbamothioylamino]-5-methylthiophene-3-carboxylate (PubChem CID 5193072) has the molecular formula C18H18N4O2S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is methyl 2-[(1-benzylpyrazol-3-yl)carbamothioylamino]-5-methylthiophene-3-carboxylate.
| Compound Name | methyl 2-[(1-benzylpyrazol-3-yl)carbamothioylamino]-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 5193072 |
| Molecular Formula | C18H18N4O2S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | methyl 2-[(1-benzylpyrazol-3-yl)carbamothioylamino]-5-methylthiophene-3-carboxylate |
| SMILES | COC(=O)c1cc(C)sc1NC(=S)Nc1ccn(Cc2ccccc2)n1 |
| InChI | InChI=1S/C18H18N4O2S2/c1-12-10-14(17(23)24-2)16(26-12)20-18(25)19-15-8-9-22(21-15)11-13-6-4-3-5-7-13/h3-10H,11H2,1-2H3,(H2,19,20,21,25) |
| InChIKey | RABZPYKFAJIEGN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|