C17H15FN4S — CID 17284114
1-(1-benzylpyrazol-3-yl)-3-(4-fluorophenyl)thiourea (PubChem CID 17284114) has the molecular formula C17H15FN4S and a molecular weight of 326.40 g/mol. Its IUPAC name is 1-(1-benzylpyrazol-3-yl)-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-(1-benzylpyrazol-3-yl)-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 17284114 |
| Molecular Formula | C17H15FN4S |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 1-(1-benzylpyrazol-3-yl)-3-(4-fluorophenyl)thiourea |
| SMILES | Fc1ccc(NC(=S)Nc2ccn(Cc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C17H15FN4S/c18-14-6-8-15(9-7-14)19-17(23)20-16-10-11-22(21-16)12-13-4-2-1-3-5-13/h1-11H,12H2,(H2,19,20,21,23) |
| InChIKey | PHRQRHNJICZHQG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|