C19H19FN4S — CID 17299221
1-(2-ethylphenyl)-3-[1-[(4-fluorophenyl)methyl]pyrazol-3-yl]thiourea (PubChem CID 17299221) has the molecular formula C19H19FN4S and a molecular weight of 354.45 g/mol. Its IUPAC name is 1-(2-ethylphenyl)-3-[1-[(4-fluorophenyl)methyl]pyrazol-3-yl]thiourea.
| Compound Name | 1-(2-ethylphenyl)-3-[1-[(4-fluorophenyl)methyl]pyrazol-3-yl]thiourea |
|---|---|
| PubChem CID | 17299221 |
| Molecular Formula | C19H19FN4S |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 1-(2-ethylphenyl)-3-[1-[(4-fluorophenyl)methyl]pyrazol-3-yl]thiourea |
| SMILES | CCc1ccccc1NC(=S)Nc1ccn(Cc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C19H19FN4S/c1-2-15-5-3-4-6-17(15)21-19(25)22-18-11-12-24(23-18)13-14-7-9-16(20)10-8-14/h3-12H,2,13H2,1H3,(H2,21,22,23,25) |
| InChIKey | OGCUMVNFZYUKBF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|