C23H22N4S — CID 19399205
1-(4-ethylphenyl)-3-[1-(naphthalen-1-ylmethyl)pyrazol-3-yl]thiourea (PubChem CID 19399205) has the molecular formula C23H22N4S and a molecular weight of 386.52 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-3-[1-(naphthalen-1-ylmethyl)pyrazol-3-yl]thiourea.
| Compound Name | 1-(4-ethylphenyl)-3-[1-(naphthalen-1-ylmethyl)pyrazol-3-yl]thiourea |
|---|---|
| PubChem CID | 19399205 |
| Molecular Formula | C23H22N4S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 1-(4-ethylphenyl)-3-[1-(naphthalen-1-ylmethyl)pyrazol-3-yl]thiourea |
| SMILES | CCc1ccc(NC(=S)Nc2ccn(Cc3cccc4ccccc34)n2)cc1 |
| InChI | InChI=1S/C23H22N4S/c1-2-17-10-12-20(13-11-17)24-23(28)25-22-14-15-27(26-22)16-19-8-5-7-18-6-3-4-9-21(18)19/h3-15H,2,16H2,1H3,(H2,24,25,26,28) |
| InChIKey | RWLAMFXRTHXPIK-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|