C20H22N4S — CID 17298831
1-[1-[(4-methylphenyl)methyl]pyrazol-3-yl]-3-(2-phenylethyl)thiourea (PubChem CID 17298831) has the molecular formula C20H22N4S and a molecular weight of 350.49 g/mol. Its IUPAC name is 1-[1-[(4-methylphenyl)methyl]pyrazol-3-yl]-3-(2-phenylethyl)thiourea.
| Compound Name | 1-[1-[(4-methylphenyl)methyl]pyrazol-3-yl]-3-(2-phenylethyl)thiourea |
|---|---|
| PubChem CID | 17298831 |
| Molecular Formula | C20H22N4S |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 1-[1-[(4-methylphenyl)methyl]pyrazol-3-yl]-3-(2-phenylethyl)thiourea |
| SMILES | Cc1ccc(Cn2ccc(NC(=S)NCCc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C20H22N4S/c1-16-7-9-18(10-8-16)15-24-14-12-19(23-24)22-20(25)21-13-11-17-5-3-2-4-6-17/h2-10,12,14H,11,13,15H2,1H3,(H2,21,22,23,25) |
| InChIKey | FEBIGCGOKBEFFA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|