C24H26N6S — CID 19401194
1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3-[1-[(3-methylphenyl)methyl]pyrazol-3-yl]thiourea (PubChem CID 19401194) has the molecular formula C24H26N6S and a molecular weight of 430.58 g/mol. Its IUPAC name is 1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3-[1-[(3-methylphenyl)methyl]pyrazol-3-yl]thiourea.
| Compound Name | 1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3-[1-[(3-methylphenyl)methyl]pyrazol-3-yl]thiourea |
|---|---|
| PubChem CID | 19401194 |
| Molecular Formula | C24H26N6S |
| Molecular Weight | 430.58 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3-[1-[(3-methylphenyl)methyl]pyrazol-3-yl]thiourea |
| SMILES | Cc1cccc(Cn2ccc(NC(=S)Nc3c(C)nn(Cc4ccccc4)c3C)n2)c1 |
| InChI | InChI=1S/C24H26N6S/c1-17-8-7-11-21(14-17)15-29-13-12-22(28-29)25-24(31)26-23-18(2)27-30(19(23)3)16-20-9-5-4-6-10-20/h4-14H,15-16H2,1-3H3,(H2,25,26,28,31) |
| InChIKey | QVFPILJRSDYKHV-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.58 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|