C25H27ClN6O2S — CID 19447739
1-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-3-[1-[(3,4-dimethoxyphenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea (PubChem CID 19447739) has the molecular formula C25H27ClN6O2S and a molecular weight of 511.05 g/mol. Its IUPAC name is 1-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-3-[1-[(3,4-dimethoxyphenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea.
| Compound Name | 1-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-3-[1-[(3,4-dimethoxyphenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19447739 |
| Molecular Formula | C25H27ClN6O2S |
| Molecular Weight | 511.05 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | 1-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-3-[1-[(3,4-dimethoxyphenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea |
| SMILES | COc1ccc(Cn2nc(C)c(NC(=S)Nc3ccn(Cc4ccc(Cl)cc4)n3)c2C)cc1OC |
| InChI | InChI=1S/C25H27ClN6O2S/c1-16-24(17(2)32(29-16)15-19-7-10-21(33-3)22(13-19)34-4)28-25(35)27-23-11-12-31(30-23)14-18-5-8-20(26)9-6-18/h5-13H,14-15H2,1-4H3,(H2,27,28,30,35) |
| InChIKey | CGZUQFWSEPEGHG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.05 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|