C20H21ClN4O2S — CID 2206874
1-[1-[(4-chlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-(3,4-dimethoxyphenyl)thiourea (PubChem CID 2206874) has the molecular formula C20H21ClN4O2S and a molecular weight of 416.93 g/mol. Its IUPAC name is 1-[1-[(4-chlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-(3,4-dimethoxyphenyl)thiourea.
| Compound Name | 1-[1-[(4-chlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-(3,4-dimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 2206874 |
| Molecular Formula | C20H21ClN4O2S |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 1-[1-[(4-chlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-(3,4-dimethoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)Nc2cc(C)n(Cc3ccc(Cl)cc3)n2)cc1OC |
| InChI | InChI=1S/C20H21ClN4O2S/c1-13-10-19(24-25(13)12-14-4-6-15(21)7-5-14)23-20(28)22-16-8-9-17(26-2)18(11-16)27-3/h4-11H,12H2,1-3H3,(H2,22,23,24,28) |
| InChIKey | MYZMGGZOSQOOPI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 60.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|