C16H21ClN4S — CID 19393273
1-butan-2-yl-3-[1-[(4-chlorophenyl)methyl]-5-methylpyrazol-3-yl]thiourea (PubChem CID 19393273) has the molecular formula C16H21ClN4S and a molecular weight of 336.89 g/mol. Its IUPAC name is 1-butan-2-yl-3-[1-[(4-chlorophenyl)methyl]-5-methylpyrazol-3-yl]thiourea.
| Compound Name | 1-butan-2-yl-3-[1-[(4-chlorophenyl)methyl]-5-methylpyrazol-3-yl]thiourea |
|---|---|
| PubChem CID | 19393273 |
| Molecular Formula | C16H21ClN4S |
| Molecular Weight | 336.89 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 1-butan-2-yl-3-[1-[(4-chlorophenyl)methyl]-5-methylpyrazol-3-yl]thiourea |
| SMILES | CCC(C)NC(=S)Nc1cc(C)n(Cc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C16H21ClN4S/c1-4-11(2)18-16(22)19-15-9-12(3)21(20-15)10-13-5-7-14(17)8-6-13/h5-9,11H,4,10H2,1-3H3,(H2,18,19,20,22) |
| InChIKey | UAVFWOMLJZCRMO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.89 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|