C18H21ClN6S — CID 19393291
1-[1-[(4-chlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-[(1-ethylpyrazol-4-yl)methyl]thiourea (PubChem CID 19393291) has the molecular formula C18H21ClN6S and a molecular weight of 388.93 g/mol. Its IUPAC name is 1-[1-[(4-chlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-[(1-ethylpyrazol-4-yl)methyl]thiourea.
| Compound Name | 1-[1-[(4-chlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-[(1-ethylpyrazol-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 19393291 |
| Molecular Formula | C18H21ClN6S |
| Molecular Weight | 388.93 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 1-[1-[(4-chlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-[(1-ethylpyrazol-4-yl)methyl]thiourea |
| SMILES | CCn1cc(CNC(=S)Nc2cc(C)n(Cc3ccc(Cl)cc3)n2)cn1 |
| InChI | InChI=1S/C18H21ClN6S/c1-3-24-11-15(10-21-24)9-20-18(26)22-17-8-13(2)25(23-17)12-14-4-6-16(19)7-5-14/h4-8,10-11H,3,9,12H2,1-2H3,(H2,20,22,23,26) |
| InChIKey | XCRSYYLXWRIGKA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.93 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|