C18H22N6S — CID 19394989
1-[(1-ethylpyrazol-4-yl)methyl]-3-[1-[(4-methylphenyl)methyl]pyrazol-3-yl]thiourea (PubChem CID 19394989) has the molecular formula C18H22N6S and a molecular weight of 354.48 g/mol. Its IUPAC name is 1-[(1-ethylpyrazol-4-yl)methyl]-3-[1-[(4-methylphenyl)methyl]pyrazol-3-yl]thiourea.
| Compound Name | 1-[(1-ethylpyrazol-4-yl)methyl]-3-[1-[(4-methylphenyl)methyl]pyrazol-3-yl]thiourea |
|---|---|
| PubChem CID | 19394989 |
| Molecular Formula | C18H22N6S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 1-[(1-ethylpyrazol-4-yl)methyl]-3-[1-[(4-methylphenyl)methyl]pyrazol-3-yl]thiourea |
| SMILES | CCn1cc(CNC(=S)Nc2ccn(Cc3ccc(C)cc3)n2)cn1 |
| InChI | InChI=1S/C18H22N6S/c1-3-23-13-16(11-20-23)10-19-18(25)21-17-8-9-24(22-17)12-15-6-4-14(2)5-7-15/h4-9,11,13H,3,10,12H2,1-2H3,(H2,19,21,22,25) |
| InChIKey | ZARALECQCFMUBO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|