C20H20BrClN4OS — CID 19679209
1-[1-[(4-bromophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(5-chloro-2-methoxyphenyl)thiourea (PubChem CID 19679209) has the molecular formula C20H20BrClN4OS and a molecular weight of 479.83 g/mol. Its IUPAC name is 1-[1-[(4-bromophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(5-chloro-2-methoxyphenyl)thiourea.
| Compound Name | 1-[1-[(4-bromophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(5-chloro-2-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 19679209 |
| Molecular Formula | C20H20BrClN4OS |
| Molecular Weight | 479.83 g/mol |
| Exact Mass | 478.02 |
| IUPAC Name | 1-[1-[(4-bromophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(5-chloro-2-methoxyphenyl)thiourea |
| SMILES | COc1ccc(Cl)cc1NC(=S)Nc1c(C)nn(Cc2ccc(Br)cc2)c1C |
| InChI | InChI=1S/C20H20BrClN4OS/c1-12-19(13(2)26(25-12)11-14-4-6-15(21)7-5-14)24-20(28)23-17-10-16(22)8-9-18(17)27-3/h4-10H,11H2,1-3H3,(H2,23,24,28) |
| InChIKey | UUTLZXGZIQODEL-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.83 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|