C20H21BrN4OS — CID 19679179
1-[1-[(4-bromophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(4-methoxyphenyl)thiourea (PubChem CID 19679179) has the molecular formula C20H21BrN4OS and a molecular weight of 445.39 g/mol. Its IUPAC name is 1-[1-[(4-bromophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-[1-[(4-bromophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 19679179 |
| Molecular Formula | C20H21BrN4OS |
| Molecular Weight | 445.39 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 1-[1-[(4-bromophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)Nc2c(C)nn(Cc3ccc(Br)cc3)c2C)cc1 |
| InChI | InChI=1S/C20H21BrN4OS/c1-13-19(23-20(27)22-17-8-10-18(26-3)11-9-17)14(2)25(24-13)12-15-4-6-16(21)7-5-15/h4-11H,12H2,1-3H3,(H2,22,23,27) |
| InChIKey | XIRSPRSOPJTMEU-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.39 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|