C15H19ClN4OS — CID 970116
1-(5-chloro-2-methoxyphenyl)-3-(1-ethyl-3,5-dimethylpyrazol-4-yl)thiourea (PubChem CID 970116) has the molecular formula C15H19ClN4OS and a molecular weight of 338.86 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-(1-ethyl-3,5-dimethylpyrazol-4-yl)thiourea.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-(1-ethyl-3,5-dimethylpyrazol-4-yl)thiourea |
|---|---|
| PubChem CID | 970116 |
| Molecular Formula | C15H19ClN4OS |
| Molecular Weight | 338.86 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-(1-ethyl-3,5-dimethylpyrazol-4-yl)thiourea |
| SMILES | CCn1nc(C)c(NC(=S)Nc2cc(Cl)ccc2OC)c1C |
| InChI | InChI=1S/C15H19ClN4OS/c1-5-20-10(3)14(9(2)19-20)18-15(22)17-12-8-11(16)6-7-13(12)21-4/h6-8H,5H2,1-4H3,(H2,17,18,22) |
| InChIKey | LQIOLXNHXPOXGU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.86 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|