C14H16ClN5O2S — CID 17299149
4-[(5-chloro-2-methoxyphenyl)carbamothioylamino]-1-ethylpyrazole-5-carboxamide (PubChem CID 17299149) has the molecular formula C14H16ClN5O2S and a molecular weight of 353.84 g/mol. Its IUPAC name is 4-[(5-chloro-2-methoxyphenyl)carbamothioylamino]-1-ethylpyrazole-5-carboxamide.
| Compound Name | 4-[(5-chloro-2-methoxyphenyl)carbamothioylamino]-1-ethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 17299149 |
| Molecular Formula | C14H16ClN5O2S |
| Molecular Weight | 353.84 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 4-[(5-chloro-2-methoxyphenyl)carbamothioylamino]-1-ethylpyrazole-5-carboxamide |
| SMILES | CCn1ncc(NC(=S)Nc2cc(Cl)ccc2OC)c1C(N)=O |
| InChI | InChI=1S/C14H16ClN5O2S/c1-3-20-12(13(16)21)10(7-17-20)19-14(23)18-9-6-8(15)4-5-11(9)22-2/h4-7H,3H2,1-2H3,(H2,16,21)(H2,18,19,23) |
| InChIKey | ITAHQDVCDJZCFI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.84 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|