C15H20N4O2S — CID 17283631
1-(2,5-dimethoxyphenyl)-3-(1,3,5-trimethylpyrazol-4-yl)thiourea (PubChem CID 17283631) has the molecular formula C15H20N4O2S and a molecular weight of 320.42 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-3-(1,3,5-trimethylpyrazol-4-yl)thiourea.
| Compound Name | 1-(2,5-dimethoxyphenyl)-3-(1,3,5-trimethylpyrazol-4-yl)thiourea |
|---|---|
| PubChem CID | 17283631 |
| Molecular Formula | C15H20N4O2S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-3-(1,3,5-trimethylpyrazol-4-yl)thiourea |
| SMILES | COc1ccc(OC)c(NC(=S)Nc2c(C)nn(C)c2C)c1 |
| InChI | InChI=1S/C15H20N4O2S/c1-9-14(10(2)19(3)18-9)17-15(22)16-12-8-11(20-4)6-7-13(12)21-5/h6-8H,1-5H3,(H2,16,17,22) |
| InChIKey | XNZCVSZSHMZZHX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 60.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|