C20H22N4O2S2 — CID 19677270
methyl 4,5-dimethyl-2-[[1-[(2-methylphenyl)methyl]pyrazol-3-yl]carbamothioylamino]thiophene-3-carboxylate (PubChem CID 19677270) has the molecular formula C20H22N4O2S2 and a molecular weight of 414.56 g/mol. Its IUPAC name is methyl 4,5-dimethyl-2-[[1-[(2-methylphenyl)methyl]pyrazol-3-yl]carbamothioylamino]thiophene-3-carboxylate.
| Compound Name | methyl 4,5-dimethyl-2-[[1-[(2-methylphenyl)methyl]pyrazol-3-yl]carbamothioylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19677270 |
| Molecular Formula | C20H22N4O2S2 |
| Molecular Weight | 414.56 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | methyl 4,5-dimethyl-2-[[1-[(2-methylphenyl)methyl]pyrazol-3-yl]carbamothioylamino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)Nc2ccn(Cc3ccccc3C)n2)sc(C)c1C |
| InChI | InChI=1S/C20H22N4O2S2/c1-12-7-5-6-8-15(12)11-24-10-9-16(23-24)21-20(27)22-18-17(19(25)26-4)13(2)14(3)28-18/h5-10H,11H2,1-4H3,(H2,21,22,23,27) |
| InChIKey | LHISIROOMIOWMO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.56 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|