C25H30N4O2S2 — CID 19677277
ethyl 2-[[1-[(2-methylphenyl)methyl]pyrazol-3-yl]carbamothioylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 19677277) has the molecular formula C25H30N4O2S2 and a molecular weight of 482.68 g/mol. Its IUPAC name is ethyl 2-[[1-[(2-methylphenyl)methyl]pyrazol-3-yl]carbamothioylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[1-[(2-methylphenyl)methyl]pyrazol-3-yl]carbamothioylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19677277 |
| Molecular Formula | C25H30N4O2S2 |
| Molecular Weight | 482.68 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | ethyl 2-[[1-[(2-methylphenyl)methyl]pyrazol-3-yl]carbamothioylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)Nc2ccn(Cc3ccccc3C)n2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C25H30N4O2S2/c1-3-31-24(30)22-19-12-6-4-5-7-13-20(19)33-23(22)27-25(32)26-21-14-15-29(28-21)16-18-11-9-8-10-17(18)2/h8-11,14-15H,3-7,12-13,16H2,1-2H3,(H2,26,27,28,32) |
| InChIKey | RXZNBHJCADATBD-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.68 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|