C27H34N4O2S2 — CID 19676956
ethyl 2-[[3,5-dimethyl-1-[(2-methylphenyl)methyl]pyrazol-4-yl]carbamothioylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 19676956) has the molecular formula C27H34N4O2S2 and a molecular weight of 510.73 g/mol. Its IUPAC name is ethyl 2-[[3,5-dimethyl-1-[(2-methylphenyl)methyl]pyrazol-4-yl]carbamothioylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[3,5-dimethyl-1-[(2-methylphenyl)methyl]pyrazol-4-yl]carbamothioylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19676956 |
| Molecular Formula | C27H34N4O2S2 |
| Molecular Weight | 510.73 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | ethyl 2-[[3,5-dimethyl-1-[(2-methylphenyl)methyl]pyrazol-4-yl]carbamothioylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)Nc2c(C)nn(Cc3ccccc3C)c2C)sc2c1CCCCCC2 |
| InChI | InChI=1S/C27H34N4O2S2/c1-5-33-26(32)23-21-14-8-6-7-9-15-22(21)35-25(23)29-27(34)28-24-18(3)30-31(19(24)4)16-20-13-11-10-12-17(20)2/h10-13H,5-9,14-16H2,1-4H3,(H2,28,29,34) |
| InChIKey | NXTPNMISOPTELK-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.73 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|