C24H26Cl2N4O2S2 — CID 19677766
ethyl 2-[[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19677766) has the molecular formula C24H26Cl2N4O2S2 and a molecular weight of 537.54 g/mol. Its IUPAC name is ethyl 2-[[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19677766 |
| Molecular Formula | C24H26Cl2N4O2S2 |
| Molecular Weight | 537.54 g/mol |
| Exact Mass | 536.09 |
| IUPAC Name | ethyl 2-[[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)Nc2c(C)nn(Cc3ccc(Cl)c(Cl)c3)c2C)sc2c1CCCC2 |
| InChI | InChI=1S/C24H26Cl2N4O2S2/c1-4-32-23(31)20-16-7-5-6-8-19(16)34-22(20)28-24(33)27-21-13(2)29-30(14(21)3)12-15-9-10-17(25)18(26)11-15/h9-11H,4-8,12H2,1-3H3,(H2,27,28,33) |
| InChIKey | KREAJYAGAYJACD-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.54 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|