C26H36N2O2S2 — CID 19687902
ethyl 2-[[2,6-di(propan-2-yl)phenyl]carbamothioylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 19687902) has the molecular formula C26H36N2O2S2 and a molecular weight of 472.72 g/mol. Its IUPAC name is ethyl 2-[[2,6-di(propan-2-yl)phenyl]carbamothioylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2,6-di(propan-2-yl)phenyl]carbamothioylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19687902 |
| Molecular Formula | C26H36N2O2S2 |
| Molecular Weight | 472.72 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | ethyl 2-[[2,6-di(propan-2-yl)phenyl]carbamothioylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)Nc2c(C(C)C)cccc2C(C)C)sc2c1CCCCCC2 |
| InChI | InChI=1S/C26H36N2O2S2/c1-6-30-25(29)22-20-12-9-7-8-10-15-21(20)32-24(22)28-26(31)27-23-18(16(2)3)13-11-14-19(23)17(4)5/h11,13-14,16-17H,6-10,12,15H2,1-5H3,(H2,27,28,31) |
| InChIKey | GYMQSHSOSQSCDL-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.72 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|