C19H24N2O2S3 — CID 19653590
ethyl 2-(thiophen-2-ylmethylcarbamothioylamino)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 19653590) has the molecular formula C19H24N2O2S3 and a molecular weight of 408.61 g/mol. Its IUPAC name is ethyl 2-(thiophen-2-ylmethylcarbamothioylamino)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-(thiophen-2-ylmethylcarbamothioylamino)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19653590 |
| Molecular Formula | C19H24N2O2S3 |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | ethyl 2-(thiophen-2-ylmethylcarbamothioylamino)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)NCc2cccs2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C19H24N2O2S3/c1-2-23-18(22)16-14-9-5-3-4-6-10-15(14)26-17(16)21-19(24)20-12-13-8-7-11-25-13/h7-8,11H,2-6,9-10,12H2,1H3,(H2,20,21,24) |
| InChIKey | DJYXKRCPGFFENW-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|