C18H23N3O2S2 — CID 19652027
methyl 2-[3-(dimethylamino)propylcarbamothioylamino]-5-phenylthiophene-3-carboxylate (PubChem CID 19652027) has the molecular formula C18H23N3O2S2 and a molecular weight of 377.54 g/mol. Its IUPAC name is methyl 2-[3-(dimethylamino)propylcarbamothioylamino]-5-phenylthiophene-3-carboxylate.
| Compound Name | methyl 2-[3-(dimethylamino)propylcarbamothioylamino]-5-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19652027 |
| Molecular Formula | C18H23N3O2S2 |
| Molecular Weight | 377.54 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | methyl 2-[3-(dimethylamino)propylcarbamothioylamino]-5-phenylthiophene-3-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccccc2)sc1NC(=S)NCCCN(C)C |
| InChI | InChI=1S/C18H23N3O2S2/c1-21(2)11-7-10-19-18(24)20-16-14(17(22)23-3)12-15(25-16)13-8-5-4-6-9-13/h4-6,8-9,12H,7,10-11H2,1-3H3,(H2,19,20,24) |
| InChIKey | KQIIOYGUXSPVDP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.54 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|