C18H16N2O2S3 — CID 19653591
methyl 5-phenyl-2-(thiophen-2-ylmethylcarbamothioylamino)thiophene-3-carboxylate (PubChem CID 19653591) has the molecular formula C18H16N2O2S3 and a molecular weight of 388.54 g/mol. Its IUPAC name is methyl 5-phenyl-2-(thiophen-2-ylmethylcarbamothioylamino)thiophene-3-carboxylate.
| Compound Name | methyl 5-phenyl-2-(thiophen-2-ylmethylcarbamothioylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19653591 |
| Molecular Formula | C18H16N2O2S3 |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | methyl 5-phenyl-2-(thiophen-2-ylmethylcarbamothioylamino)thiophene-3-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccccc2)sc1NC(=S)NCc1cccs1 |
| InChI | InChI=1S/C18H16N2O2S3/c1-22-17(21)14-10-15(12-6-3-2-4-7-12)25-16(14)20-18(23)19-11-13-8-5-9-24-13/h2-10H,11H2,1H3,(H2,19,20,23) |
| InChIKey | PIPMKZOVEMTACR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|