C20H23ClN6O2S — CID 19344738
propan-2-yl 4-[[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]carbamothioylamino]-1-ethylpyrazole-3-carboxylate (PubChem CID 19344738) has the molecular formula C20H23ClN6O2S and a molecular weight of 446.96 g/mol. Its IUPAC name is propan-2-yl 4-[[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]carbamothioylamino]-1-ethylpyrazole-3-carboxylate.
| Compound Name | propan-2-yl 4-[[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]carbamothioylamino]-1-ethylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 19344738 |
| Molecular Formula | C20H23ClN6O2S |
| Molecular Weight | 446.96 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | propan-2-yl 4-[[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]carbamothioylamino]-1-ethylpyrazole-3-carboxylate |
| SMILES | CCn1cc(NC(=S)Nc2cnn(Cc3ccccc3Cl)c2)c(C(=O)OC(C)C)n1 |
| InChI | InChI=1S/C20H23ClN6O2S/c1-4-26-12-17(18(25-26)19(28)29-13(2)3)24-20(30)23-15-9-22-27(11-15)10-14-7-5-6-8-16(14)21/h5-9,11-13H,4,10H2,1-3H3,(H2,23,24,30) |
| InChIKey | OGGVWUJVXPTPHN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 86.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.96 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|