C23H20N4O2S — CID 17375236
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[1-(naphthalen-1-ylmethyl)pyrazol-4-yl]thiourea (PubChem CID 17375236) has the molecular formula C23H20N4O2S and a molecular weight of 416.51 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[1-(naphthalen-1-ylmethyl)pyrazol-4-yl]thiourea.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[1-(naphthalen-1-ylmethyl)pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 17375236 |
| Molecular Formula | C23H20N4O2S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[1-(naphthalen-1-ylmethyl)pyrazol-4-yl]thiourea |
| SMILES | S=C(Nc1ccc2c(c1)OCCO2)Nc1cnn(Cc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C23H20N4O2S/c30-23(25-18-8-9-21-22(12-18)29-11-10-28-21)26-19-13-24-27(15-19)14-17-6-3-5-16-4-1-2-7-20(16)17/h1-9,12-13,15H,10-11,14H2,(H2,25,26,30) |
| InChIKey | WEQNOIJBZNOMCD-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 60.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|