C22H22N2O2S — CID 100757202
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(3-naphthalen-1-ylpropyl)thiourea (PubChem CID 100757202) has the molecular formula C22H22N2O2S and a molecular weight of 378.50 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(3-naphthalen-1-ylpropyl)thiourea.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(3-naphthalen-1-ylpropyl)thiourea |
|---|---|
| PubChem CID | 100757202 |
| Molecular Formula | C22H22N2O2S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(3-naphthalen-1-ylpropyl)thiourea |
| SMILES | S=C(NCCCc1cccc2ccccc12)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C22H22N2O2S/c27-22(24-18-10-11-20-21(15-18)26-14-13-25-20)23-12-4-8-17-7-3-6-16-5-1-2-9-19(16)17/h1-3,5-7,9-11,15H,4,8,12-14H2,(H2,23,24,27) |
| InChIKey | RTVFGLDOVNOPQS-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|