C22H24N2O2S — CID 100757098
1-(3,4-dimethoxyphenyl)-3-(3-naphthalen-1-ylpropyl)thiourea (PubChem CID 100757098) has the molecular formula C22H24N2O2S and a molecular weight of 380.51 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-(3-naphthalen-1-ylpropyl)thiourea.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-(3-naphthalen-1-ylpropyl)thiourea |
|---|---|
| PubChem CID | 100757098 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-(3-naphthalen-1-ylpropyl)thiourea |
| SMILES | COc1ccc(NC(=S)NCCCc2cccc3ccccc23)cc1OC |
| InChI | InChI=1S/C22H24N2O2S/c1-25-20-13-12-18(15-21(20)26-2)24-22(27)23-14-6-10-17-9-5-8-16-7-3-4-11-19(16)17/h3-5,7-9,11-13,15H,6,10,14H2,1-2H3,(H2,23,24,27) |
| InChIKey | VSPYENDYMUZFIB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|