C21H17ClN4O — CID 19447846
1-(4-chlorophenyl)-3-[1-(naphthalen-1-ylmethyl)pyrazol-4-yl]urea (PubChem CID 19447846) has the molecular formula C21H17ClN4O and a molecular weight of 376.85 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[1-(naphthalen-1-ylmethyl)pyrazol-4-yl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[1-(naphthalen-1-ylmethyl)pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 19447846 |
| Molecular Formula | C21H17ClN4O |
| Molecular Weight | 376.85 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[1-(naphthalen-1-ylmethyl)pyrazol-4-yl]urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)Nc1cnn(Cc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C21H17ClN4O/c22-17-8-10-18(11-9-17)24-21(27)25-19-12-23-26(14-19)13-16-6-3-5-15-4-1-2-7-20(15)16/h1-12,14H,13H2,(H2,24,25,27) |
| InChIKey | ZLVHJUMOCZRZEJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.85 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |