C18H26F3N3OS — CID 19291457
N-(3-ethoxypropyl)-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine-1-carbothioamide (PubChem CID 19291457) has the molecular formula C18H26F3N3OS and a molecular weight of 389.49 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine-1-carbothioamide.
| Compound Name | N-(3-ethoxypropyl)-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19291457 |
| Molecular Formula | C18H26F3N3OS |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | N-(3-ethoxypropyl)-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine-1-carbothioamide |
| SMILES | CCOCCCNC(=S)N1CCN(Cc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C18H26F3N3OS/c1-2-25-12-4-7-22-17(26)24-10-8-23(9-11-24)14-15-5-3-6-16(13-15)18(19,20)21/h3,5-6,13H,2,4,7-12,14H2,1H3,(H,22,26) |
| InChIKey | OVZYFWWMUBNDBE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|