C15H22FN3OS — CID 2170942
4-[(3-fluorophenyl)methyl]-N-(2-methoxyethyl)piperazine-1-carbothioamide (PubChem CID 2170942) has the molecular formula C15H22FN3OS and a molecular weight of 311.43 g/mol. Its IUPAC name is 4-[(3-fluorophenyl)methyl]-N-(2-methoxyethyl)piperazine-1-carbothioamide.
| Compound Name | 4-[(3-fluorophenyl)methyl]-N-(2-methoxyethyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 2170942 |
| Molecular Formula | C15H22FN3OS |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 4-[(3-fluorophenyl)methyl]-N-(2-methoxyethyl)piperazine-1-carbothioamide |
| SMILES | COCCNC(=S)N1CCN(Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C15H22FN3OS/c1-20-10-5-17-15(21)19-8-6-18(7-9-19)12-13-3-2-4-14(16)11-13/h2-4,11H,5-10,12H2,1H3,(H,17,21) |
| InChIKey | YZBGGTAMRRICFM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|