C10H21N3OS — CID 3191985
4-ethyl-N-(2-methoxyethyl)piperazine-1-carbothioamide (PubChem CID 3191985) has the molecular formula C10H21N3OS and a molecular weight of 231.36 g/mol. Its IUPAC name is 4-ethyl-N-(2-methoxyethyl)piperazine-1-carbothioamide.
| Compound Name | 4-ethyl-N-(2-methoxyethyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3191985 |
| Molecular Formula | C10H21N3OS |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 4-ethyl-N-(2-methoxyethyl)piperazine-1-carbothioamide |
| SMILES | CCN1CCN(C(=S)NCCOC)CC1 |
| InChI | InChI=1S/C10H21N3OS/c1-3-12-5-7-13(8-6-12)10(15)11-4-9-14-2/h3-9H2,1-2H3,(H,11,15) |
| InChIKey | WJDURXPWSMOTFA-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|