C16H23ClN4O2S — CID 9214697
N-(2-chlorophenyl)-2-[4-(2-methoxyethylcarbamothioyl)piperazin-1-yl]acetamide (PubChem CID 9214697) has the molecular formula C16H23ClN4O2S and a molecular weight of 370.91 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[4-(2-methoxyethylcarbamothioyl)piperazin-1-yl]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[4-(2-methoxyethylcarbamothioyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 9214697 |
| Molecular Formula | C16H23ClN4O2S |
| Molecular Weight | 370.91 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | N-(2-chlorophenyl)-2-[4-(2-methoxyethylcarbamothioyl)piperazin-1-yl]acetamide |
| SMILES | COCCNC(=S)N1CCN(CC(=O)Nc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C16H23ClN4O2S/c1-23-11-6-18-16(24)21-9-7-20(8-10-21)12-15(22)19-14-5-3-2-4-13(14)17/h2-5H,6-12H2,1H3,(H,18,24)(H,19,22) |
| InChIKey | HYIWDZUAMSLRHR-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.91 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|