C16H22ClN3O3 — CID 31955891
methyl 3-[4-[2-(2-chloroanilino)-2-oxoethyl]piperazin-1-yl]propanoate (PubChem CID 31955891) has the molecular formula C16H22ClN3O3 and a molecular weight of 339.82 g/mol. Its IUPAC name is methyl 3-[4-[2-(2-chloroanilino)-2-oxoethyl]piperazin-1-yl]propanoate.
| Compound Name | methyl 3-[4-[2-(2-chloroanilino)-2-oxoethyl]piperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 31955891 |
| Molecular Formula | C16H22ClN3O3 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | methyl 3-[4-[2-(2-chloroanilino)-2-oxoethyl]piperazin-1-yl]propanoate |
| SMILES | COC(=O)CCN1CCN(CC(=O)Nc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C16H22ClN3O3/c1-23-16(22)6-7-19-8-10-20(11-9-19)12-15(21)18-14-5-3-2-4-13(14)17/h2-5H,6-12H2,1H3,(H,18,21) |
| InChIKey | ICKVFNLPVJLZHM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |