C17H24ClN3O — CID 8800016
N-(2-chlorophenyl)-2-[4-(3-methylbut-2-enyl)piperazin-1-yl]acetamide (PubChem CID 8800016) has the molecular formula C17H24ClN3O and a molecular weight of 321.85 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[4-(3-methylbut-2-enyl)piperazin-1-yl]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[4-(3-methylbut-2-enyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 8800016 |
| Molecular Formula | C17H24ClN3O |
| Molecular Weight | 321.85 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | N-(2-chlorophenyl)-2-[4-(3-methylbut-2-enyl)piperazin-1-yl]acetamide |
| SMILES | CC(C)=CCN1CCN(CC(=O)Nc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C17H24ClN3O/c1-14(2)7-8-20-9-11-21(12-10-20)13-17(22)19-16-6-4-3-5-15(16)18/h3-7H,8-13H2,1-2H3,(H,19,22) |
| InChIKey | SCLAYPPTXNZZGX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.85 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|