C20H29ClN4OS — CID 9214799
N-(2-chlorophenyl)-2-[4-[[(1R,2R)-2-methylcyclohexyl]carbamothioyl]piperazin-1-yl]acetamide (PubChem CID 9214799) has the molecular formula C20H29ClN4OS and a molecular weight of 409.00 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[4-[[(1R,2R)-2-methylcyclohexyl]carbamothioyl]piperazin-1-yl]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[4-[[(1R,2R)-2-methylcyclohexyl]carbamothioyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 9214799 |
| Molecular Formula | C20H29ClN4OS |
| Molecular Weight | 409.00 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | N-(2-chlorophenyl)-2-[4-[[(1R,2R)-2-methylcyclohexyl]carbamothioyl]piperazin-1-yl]acetamide |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=S)N1CCN(CC(=O)Nc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C20H29ClN4OS/c1-15-6-2-4-8-17(15)23-20(27)25-12-10-24(11-13-25)14-19(26)22-18-9-5-3-7-16(18)21/h3,5,7,9,15,17H,2,4,6,8,10-14H2,1H3,(H,22,26)(H,23,27)/t15-,17-/m1/s1 |
| InChIKey | DABNRETWAQLJSJ-NVXWUHKLSA-N |
| XLogP | 3.35 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.00 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|