C9H18N2OS2 — CID 115587666
N-(2-methoxyethyl)-1,4-thiazepane-4-carbothioamide (PubChem CID 115587666) has the molecular formula C9H18N2OS2 and a molecular weight of 234.39 g/mol. Its IUPAC name is N-(2-methoxyethyl)-1,4-thiazepane-4-carbothioamide.
| Compound Name | N-(2-methoxyethyl)-1,4-thiazepane-4-carbothioamide |
|---|---|
| PubChem CID | 115587666 |
| Molecular Formula | C9H18N2OS2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | N-(2-methoxyethyl)-1,4-thiazepane-4-carbothioamide |
| SMILES | COCCNC(=S)N1CCCSCC1 |
| InChI | InChI=1S/C9H18N2OS2/c1-12-6-3-10-9(13)11-4-2-7-14-8-5-11/h2-8H2,1H3,(H,10,13) |
| InChIKey | CPKVNLVNSWKNMT-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|