C10H20N2OS2 — CID 115611482
N-(3-methoxypropyl)-2-methylthiomorpholine-4-carbothioamide (PubChem CID 115611482) has the molecular formula C10H20N2OS2 and a molecular weight of 248.42 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-methylthiomorpholine-4-carbothioamide.
| Compound Name | N-(3-methoxypropyl)-2-methylthiomorpholine-4-carbothioamide |
|---|---|
| PubChem CID | 115611482 |
| Molecular Formula | C10H20N2OS2 |
| Molecular Weight | 248.42 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | N-(3-methoxypropyl)-2-methylthiomorpholine-4-carbothioamide |
| SMILES | COCCCNC(=S)N1CCSC(C)C1 |
| InChI | InChI=1S/C10H20N2OS2/c1-9-8-12(5-7-15-9)10(14)11-4-3-6-13-2/h9H,3-8H2,1-2H3,(H,11,14) |
| InChIKey | PDLBBHQPFREKFS-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.42 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|