C12H16N2OS — CID 115616217
N-(2-methoxyethyl)-1,3-dihydroisoindole-2-carbothioamide (PubChem CID 115616217) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is N-(2-methoxyethyl)-1,3-dihydroisoindole-2-carbothioamide.
| Compound Name | N-(2-methoxyethyl)-1,3-dihydroisoindole-2-carbothioamide |
|---|---|
| PubChem CID | 115616217 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | N-(2-methoxyethyl)-1,3-dihydroisoindole-2-carbothioamide |
| SMILES | COCCNC(=S)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C12H16N2OS/c1-15-7-6-13-12(16)14-8-10-4-2-3-5-11(10)9-14/h2-5H,6-9H2,1H3,(H,13,16) |
| InChIKey | RCIQNUAJGPQGNJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|