C18H20N2S2 — CID 9052961
N-(2-phenylsulfanylethyl)-3,4-dihydro-1H-isoquinoline-2-carbothioamide (PubChem CID 9052961) has the molecular formula C18H20N2S2 and a molecular weight of 328.51 g/mol. Its IUPAC name is N-(2-phenylsulfanylethyl)-3,4-dihydro-1H-isoquinoline-2-carbothioamide.
| Compound Name | N-(2-phenylsulfanylethyl)-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
|---|---|
| PubChem CID | 9052961 |
| Molecular Formula | C18H20N2S2 |
| Molecular Weight | 328.51 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | N-(2-phenylsulfanylethyl)-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
| SMILES | S=C(NCCSc1ccccc1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C18H20N2S2/c21-18(19-11-13-22-17-8-2-1-3-9-17)20-12-10-15-6-4-5-7-16(15)14-20/h1-9H,10-14H2,(H,19,21) |
| InChIKey | KZCYAOXWOCHBFV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.51 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|