C17H19NS — CID 901226
2-(2-phenylsulfanylethyl)-3,4-dihydro-1H-isoquinoline (PubChem CID 901226) has the molecular formula C17H19NS and a molecular weight of 269.41 g/mol. Its IUPAC name is 2-(2-phenylsulfanylethyl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-(2-phenylsulfanylethyl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 901226 |
| Molecular Formula | C17H19NS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-(2-phenylsulfanylethyl)-3,4-dihydro-1H-isoquinoline |
| SMILES | c1ccc(SCCN2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C17H19NS/c1-2-8-17(9-3-1)19-13-12-18-11-10-15-6-4-5-7-16(15)14-18/h1-9H,10-14H2 |
| InChIKey | VWQFSNFMGSOQIG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |