C17H19FN2S — CID 61014282
2-[2-(4-fluorophenyl)sulfanylethyl]-3,4-dihydro-1H-isoquinolin-5-amine (PubChem CID 61014282) has the molecular formula C17H19FN2S and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)sulfanylethyl]-3,4-dihydro-1H-isoquinolin-5-amine.
| Compound Name | 2-[2-(4-fluorophenyl)sulfanylethyl]-3,4-dihydro-1H-isoquinolin-5-amine |
|---|---|
| PubChem CID | 61014282 |
| Molecular Formula | C17H19FN2S |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 2-[2-(4-fluorophenyl)sulfanylethyl]-3,4-dihydro-1H-isoquinolin-5-amine |
| SMILES | Nc1cccc2c1CCN(CCSc1ccc(F)cc1)C2 |
| InChI | InChI=1S/C17H19FN2S/c18-14-4-6-15(7-5-14)21-11-10-20-9-8-16-13(12-20)2-1-3-17(16)19/h1-7H,8-12,19H2 |
| InChIKey | VWBUXZNQXQZNNO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|