C17H18ClN — CID 82214226
2-(2-chloro-2-phenylethyl)-3,4-dihydro-1H-isoquinoline (PubChem CID 82214226) has the molecular formula C17H18ClN and a molecular weight of 271.79 g/mol. Its IUPAC name is 2-(2-chloro-2-phenylethyl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-(2-chloro-2-phenylethyl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 82214226 |
| Molecular Formula | C17H18ClN |
| Molecular Weight | 271.79 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 2-(2-chloro-2-phenylethyl)-3,4-dihydro-1H-isoquinoline |
| SMILES | ClC(CN1CCc2ccccc2C1)c1ccccc1 |
| InChI | InChI=1S/C17H18ClN/c18-17(15-7-2-1-3-8-15)13-19-11-10-14-6-4-5-9-16(14)12-19/h1-9,17H,10-13H2 |
| InChIKey | SGCOZMWPWXIXDZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.79 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|