C21H26N2O2 — CID 134334488
3-[[(2R)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]amino]-2-phenylpropanal (PubChem CID 134334488) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 3-[[(2R)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]amino]-2-phenylpropanal.
| Compound Name | 3-[[(2R)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]amino]-2-phenylpropanal |
|---|---|
| PubChem CID | 134334488 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 3-[[(2R)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]amino]-2-phenylpropanal |
| SMILES | O=CC(CNC[C@@H](O)CN1CCc2ccccc2C1)c1ccccc1 |
| InChI | InChI=1S/C21H26N2O2/c24-16-20(17-6-2-1-3-7-17)12-22-13-21(25)15-23-11-10-18-8-4-5-9-19(18)14-23/h1-9,16,20-22,25H,10-15H2/t20?,21-/m1/s1 |
| InChIKey | ZVUZYRVMYOMZCK-BPGUCPLFSA-N |
| XLogP | 1.98 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|