C24H30N4O3 — CID 134334672
3-[[3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]amino]-2-(1,3-dimethylindazol-4-yl)oxypropanal (PubChem CID 134334672) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is 3-[[3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]amino]-2-(1,3-dimethylindazol-4-yl)oxypropanal.
| Compound Name | 3-[[3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]amino]-2-(1,3-dimethylindazol-4-yl)oxypropanal |
|---|---|
| PubChem CID | 134334672 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 3-[[3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]amino]-2-(1,3-dimethylindazol-4-yl)oxypropanal |
| SMILES | Cc1nn(C)c2cccc(OC(C=O)CNCC(O)CN3CCc4ccccc4C3)c12 |
| InChI | InChI=1S/C24H30N4O3/c1-17-24-22(27(2)26-17)8-5-9-23(24)31-21(16-29)13-25-12-20(30)15-28-11-10-18-6-3-4-7-19(18)14-28/h3-9,16,20-21,25,30H,10-15H2,1-2H3 |
| InChIKey | ZEMZLNSCVLXUKB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|