C22H28N4O2 — CID 130451772
1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[2-(1-methylbenzimidazol-5-yl)oxyethylamino]propan-2-ol (PubChem CID 130451772) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[2-(1-methylbenzimidazol-5-yl)oxyethylamino]propan-2-ol.
| Compound Name | 1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[2-(1-methylbenzimidazol-5-yl)oxyethylamino]propan-2-ol |
|---|---|
| PubChem CID | 130451772 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[2-(1-methylbenzimidazol-5-yl)oxyethylamino]propan-2-ol |
| SMILES | Cn1cnc2cc(OCCNCC(O)CN3CCc4ccccc4C3)ccc21 |
| InChI | InChI=1S/C22H28N4O2/c1-25-16-24-21-12-20(6-7-22(21)25)28-11-9-23-13-19(27)15-26-10-8-17-4-2-3-5-18(17)14-26/h2-7,12,16,19,23,27H,8-11,13-15H2,1H3 |
| InChIKey | SQAWEXSTIUKEPN-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|