C27H32N2O3 — CID 26406279
(2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[3-[(2-phenoxyethylamino)methyl]phenoxy]propan-2-ol (PubChem CID 26406279) has the molecular formula C27H32N2O3 and a molecular weight of 432.56 g/mol. Its IUPAC name is (2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[3-[(2-phenoxyethylamino)methyl]phenoxy]propan-2-ol.
| Compound Name | (2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[3-[(2-phenoxyethylamino)methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 26406279 |
| Molecular Formula | C27H32N2O3 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | (2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[3-[(2-phenoxyethylamino)methyl]phenoxy]propan-2-ol |
| SMILES | O[C@H](COc1cccc(CNCCOc2ccccc2)c1)CN1CCc2ccccc2C1 |
| InChI | InChI=1S/C27H32N2O3/c30-25(20-29-15-13-23-8-4-5-9-24(23)19-29)21-32-27-12-6-7-22(17-27)18-28-14-16-31-26-10-2-1-3-11-26/h1-12,17,25,28,30H,13-16,18-21H2/t25-/m0/s1 |
| InChIKey | ARPHLMHKFPDYRY-VWLOTQADSA-N |
| XLogP | 3.65 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|