C25H32N4O2 — CID 25385262
(2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[3-[[2-(1-methylpyrazol-4-yl)ethylamino]methyl]phenoxy]propan-2-ol (PubChem CID 25385262) has the molecular formula C25H32N4O2 and a molecular weight of 420.56 g/mol. Its IUPAC name is (2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[3-[[2-(1-methylpyrazol-4-yl)ethylamino]methyl]phenoxy]propan-2-ol.
| Compound Name | (2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[3-[[2-(1-methylpyrazol-4-yl)ethylamino]methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 25385262 |
| Molecular Formula | C25H32N4O2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | (2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[3-[[2-(1-methylpyrazol-4-yl)ethylamino]methyl]phenoxy]propan-2-ol |
| SMILES | Cn1cc(CCNCc2cccc(OC[C@@H](O)CN3CCc4ccccc4C3)c2)cn1 |
| InChI | InChI=1S/C25H32N4O2/c1-28-16-21(15-27-28)9-11-26-14-20-5-4-8-25(13-20)31-19-24(30)18-29-12-10-22-6-2-3-7-23(22)17-29/h2-8,13,15-16,24,26,30H,9-12,14,17-19H2,1H3/t24-/m0/s1 |
| InChIKey | WBWPETXPBKZMJY-DEOSSOPVSA-N |
| XLogP | 2.55 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|